C15H17ClN6O2 — CID 112946585
4-[3-(3-chloro-4-methoxyanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde (PubChem CID 112946585) has the molecular formula C15H17ClN6O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is 4-[3-(3-chloro-4-methoxyanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(3-chloro-4-methoxyanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112946585 |
| Molecular Formula | C15H17ClN6O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-[3-(3-chloro-4-methoxyanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
| SMILES | COc1ccc(Nc2nncc(N3CCN(C=O)CC3)n2)cc1Cl |
| InChI | InChI=1S/C15H17ClN6O2/c1-24-13-3-2-11(8-12(13)16)18-15-19-14(9-17-20-15)22-6-4-21(10-23)5-7-22/h2-3,8-10H,4-7H2,1H3,(H,18,19,20) |
| InChIKey | YRHOMBVERXTQFG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|