C16H20N6O2 — CID 112946592
4-[3-(2-ethoxyanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde (PubChem CID 112946592) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-[3-(2-ethoxyanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(2-ethoxyanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112946592 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 4-[3-(2-ethoxyanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
| SMILES | CCOc1ccccc1Nc1nncc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C16H20N6O2/c1-2-24-14-6-4-3-5-13(14)18-16-19-15(11-17-20-16)22-9-7-21(12-23)8-10-22/h3-6,11-12H,2,7-10H2,1H3,(H,18,19,20) |
| InChIKey | XAVGTYNYYWIAKF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|