C21H23N5O — CID 112942724
5-(4-methylpiperidin-1-yl)-N-(2-phenoxyphenyl)-1,2,4-triazin-3-amine (PubChem CID 112942724) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 5-(4-methylpiperidin-1-yl)-N-(2-phenoxyphenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-methylpiperidin-1-yl)-N-(2-phenoxyphenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112942724 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 5-(4-methylpiperidin-1-yl)-N-(2-phenoxyphenyl)-1,2,4-triazin-3-amine |
| SMILES | CC1CCN(c2cnnc(Nc3ccccc3Oc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C21H23N5O/c1-16-11-13-26(14-12-16)20-15-22-25-21(24-20)23-18-9-5-6-10-19(18)27-17-7-3-2-4-8-17/h2-10,15-16H,11-14H2,1H3,(H,23,24,25) |
| InChIKey | OHOKVFVVDKYPLN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |