C15H16F3N5 — CID 112942742
5-(4-methylpiperidin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine (PubChem CID 112942742) has the molecular formula C15H16F3N5 and a molecular weight of 323.32 g/mol. Its IUPAC name is 5-(4-methylpiperidin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-methylpiperidin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112942742 |
| Molecular Formula | C15H16F3N5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 5-(4-methylpiperidin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine |
| SMILES | CC1CCN(c2cnnc(Nc3ccc(F)c(F)c3F)n2)CC1 |
| InChI | InChI=1S/C15H16F3N5/c1-9-4-6-23(7-5-9)12-8-19-22-15(21-12)20-11-3-2-10(16)13(17)14(11)18/h2-3,8-9H,4-7H2,1H3,(H,20,21,22) |
| InChIKey | NASPEEPSBKLTCD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|