C15H15F3N6O — CID 112946996
1-[4-[3-(2,3,4-trifluoroanilino)-1,2,4-triazin-5-yl]piperazin-1-yl]ethanone (PubChem CID 112946996) has the molecular formula C15H15F3N6O and a molecular weight of 352.32 g/mol. Its IUPAC name is 1-[4-[3-(2,3,4-trifluoroanilino)-1,2,4-triazin-5-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(2,3,4-trifluoroanilino)-1,2,4-triazin-5-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 112946996 |
| Molecular Formula | C15H15F3N6O |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-[4-[3-(2,3,4-trifluoroanilino)-1,2,4-triazin-5-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cnnc(Nc3ccc(F)c(F)c3F)n2)CC1 |
| InChI | InChI=1S/C15H15F3N6O/c1-9(25)23-4-6-24(7-5-23)12-8-19-22-15(21-12)20-11-3-2-10(16)13(17)14(11)18/h2-3,8H,4-7H2,1H3,(H,20,21,22) |
| InChIKey | DDTFYSDUXGPKIF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|