C18H22N6O3 — CID 112946991
ethyl 2-[[5-(4-acetylpiperazin-1-yl)-1,2,4-triazin-3-yl]amino]benzoate (PubChem CID 112946991) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 2-[[5-(4-acetylpiperazin-1-yl)-1,2,4-triazin-3-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-(4-acetylpiperazin-1-yl)-1,2,4-triazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 112946991 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | ethyl 2-[[5-(4-acetylpiperazin-1-yl)-1,2,4-triazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nncc(N2CCN(C(C)=O)CC2)n1 |
| InChI | InChI=1S/C18H22N6O3/c1-3-27-17(26)14-6-4-5-7-15(14)20-18-21-16(12-19-22-18)24-10-8-23(9-11-24)13(2)25/h4-7,12H,3,8-11H2,1-2H3,(H,20,21,22) |
| InChIKey | ILUKAGDLTMQYQY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |