C17H20N4O2 — CID 112883979
ethyl 2-[(4-pyrrolidin-1-ylpyrimidin-2-yl)amino]benzoate (PubChem CID 112883979) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl 2-[(4-pyrrolidin-1-ylpyrimidin-2-yl)amino]benzoate.
| Compound Name | ethyl 2-[(4-pyrrolidin-1-ylpyrimidin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 112883979 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethyl 2-[(4-pyrrolidin-1-ylpyrimidin-2-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nccc(N2CCCC2)n1 |
| InChI | InChI=1S/C17H20N4O2/c1-2-23-16(22)13-7-3-4-8-14(13)19-17-18-10-9-15(20-17)21-11-5-6-12-21/h3-4,7-10H,2,5-6,11-12H2,1H3,(H,18,19,20) |
| InChIKey | WLWFKWSQYVPDFN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |