C17H15F3N8 — CID 112958097
5-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine (PubChem CID 112958097) has the molecular formula C17H15F3N8 and a molecular weight of 388.36 g/mol. Its IUPAC name is 5-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112958097 |
| Molecular Formula | C17H15F3N8 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 5-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine |
| SMILES | Fc1ccc(Nc2nncc(N3CCN(c4ncccn4)CC3)n2)c(F)c1F |
| InChI | InChI=1S/C17H15F3N8/c18-11-2-3-12(15(20)14(11)19)24-16-25-13(10-23-26-16)27-6-8-28(9-7-27)17-21-4-1-5-22-17/h1-5,10H,6-9H2,(H,24,25,26) |
| InChIKey | YINJUJPJBZSCAT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|