C16H16F3N5O2 — CID 112956574
5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine (PubChem CID 112956574) has the molecular formula C16H16F3N5O2 and a molecular weight of 367.33 g/mol. Its IUPAC name is 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112956574 |
| Molecular Formula | C16H16F3N5O2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-3-amine |
| SMILES | Fc1ccc(Nc2nncc(N3CCC4(CC3)OCCO4)n2)c(F)c1F |
| InChI | InChI=1S/C16H16F3N5O2/c17-10-1-2-11(14(19)13(10)18)21-15-22-12(9-20-23-15)24-5-3-16(4-6-24)25-7-8-26-16/h1-2,9H,3-8H2,(H,21,22,23) |
| InChIKey | XIWYSMOISLCYLU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|