C19H18F3N3O3 — CID 109160028
6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2,3,4-trifluorophenyl)pyridine-3-carboxamide (PubChem CID 109160028) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2,3,4-trifluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2,3,4-trifluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109160028 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2,3,4-trifluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(N2CCC3(CC2)OCCO3)nc1 |
| InChI | InChI=1S/C19H18F3N3O3/c20-13-2-3-14(17(22)16(13)21)24-18(26)12-1-4-15(23-11-12)25-7-5-19(6-8-25)27-9-10-28-19/h1-4,11H,5-10H2,(H,24,26) |
| InChIKey | VQKRWLSMTCHHKK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|