C16H17F2N5O — CID 112914641
4-[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112914641) has the molecular formula C16H17F2N5O and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112914641 |
| Molecular Formula | C16H17F2N5O |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | Cc1cc(N2CCN(C=O)CC2)nc(Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C16H17F2N5O/c1-11-8-15(23-6-4-22(10-24)5-7-23)21-16(19-11)20-12-2-3-13(17)14(18)9-12/h2-3,8-10H,4-7H2,1H3,(H,19,20,21) |
| InChIKey | MIKGUXIQZXASEW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|