C18H21N5O3 — CID 112914594
methyl 2-[[4-(4-formylpiperazin-1-yl)-6-methylpyrimidin-2-yl]amino]benzoate (PubChem CID 112914594) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is methyl 2-[[4-(4-formylpiperazin-1-yl)-6-methylpyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 2-[[4-(4-formylpiperazin-1-yl)-6-methylpyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112914594 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl 2-[[4-(4-formylpiperazin-1-yl)-6-methylpyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1nc(C)cc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C18H21N5O3/c1-13-11-16(23-9-7-22(12-24)8-10-23)21-18(19-13)20-15-6-4-3-5-14(15)17(25)26-2/h3-6,11-12H,7-10H2,1-2H3,(H,19,20,21) |
| InChIKey | OBVBPDMNFDMKTD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|