C14H12N4O2 — CID 110383551
methyl 2-[(4-cyano-6-methylpyrimidin-2-yl)amino]benzoate (PubChem CID 110383551) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is methyl 2-[(4-cyano-6-methylpyrimidin-2-yl)amino]benzoate.
| Compound Name | methyl 2-[(4-cyano-6-methylpyrimidin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 110383551 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | methyl 2-[(4-cyano-6-methylpyrimidin-2-yl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1nc(C)cc(C#N)n1 |
| InChI | InChI=1S/C14H12N4O2/c1-9-7-10(8-15)17-14(16-9)18-12-6-4-3-5-11(12)13(19)20-2/h3-7H,1-2H3,(H,16,17,18) |
| InChIKey | OMPSEQNFVXRXAH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |