C17H18F3N5O — CID 112914587
4-[6-methyl-2-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112914587) has the molecular formula C17H18F3N5O and a molecular weight of 365.36 g/mol. Its IUPAC name is 4-[6-methyl-2-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-methyl-2-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112914587 |
| Molecular Formula | C17H18F3N5O |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-[6-methyl-2-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | Cc1cc(N2CCN(C=O)CC2)nc(Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C17H18F3N5O/c1-12-10-15(25-8-6-24(11-26)7-9-25)23-16(21-12)22-14-5-3-2-4-13(14)17(18,19)20/h2-5,10-11H,6-9H2,1H3,(H,21,22,23) |
| InChIKey | VVXLWTVGABNRLA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|