C21H22F2N6 — CID 112968968
3-N-(3,4-difluorophenyl)-5-N-[4-(4-methylpiperidin-1-yl)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112968968) has the molecular formula C21H22F2N6 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-N-(3,4-difluorophenyl)-5-N-[4-(4-methylpiperidin-1-yl)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(3,4-difluorophenyl)-5-N-[4-(4-methylpiperidin-1-yl)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112968968 |
| Molecular Formula | C21H22F2N6 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-N-(3,4-difluorophenyl)-5-N-[4-(4-methylpiperidin-1-yl)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CC1CCN(c2ccc(Nc3cnnc(Nc4ccc(F)c(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C21H22F2N6/c1-14-8-10-29(11-9-14)17-5-2-15(3-6-17)25-20-13-24-28-21(27-20)26-16-4-7-18(22)19(23)12-16/h2-7,12-14H,8-11H2,1H3,(H2,25,26,27,28) |
| InChIKey | QBAQXYFBPPACFF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|