C20H21F2N7 — CID 112969007
3-N-(2,6-difluorophenyl)-5-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112969007) has the molecular formula C20H21F2N7 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-N-(2,6-difluorophenyl)-5-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2,6-difluorophenyl)-5-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112969007 |
| Molecular Formula | C20H21F2N7 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-N-(2,6-difluorophenyl)-5-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CN1CCN(c2ccc(Nc3cnnc(Nc4c(F)cccc4F)n3)cc2)CC1 |
| InChI | InChI=1S/C20H21F2N7/c1-28-9-11-29(12-10-28)15-7-5-14(6-8-15)24-18-13-23-27-20(25-18)26-19-16(21)3-2-4-17(19)22/h2-8,13H,9-12H2,1H3,(H2,24,25,26,27) |
| InChIKey | XJGFISHQPSMIGV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|