C19H27N7O — CID 112944669
5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N-(oxolan-2-ylmethyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112944669) has the molecular formula C19H27N7O and a molecular weight of 369.47 g/mol. Its IUPAC name is 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N-(oxolan-2-ylmethyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N-(oxolan-2-ylmethyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112944669 |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N-(oxolan-2-ylmethyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CN1CCN(c2ccc(Nc3cnnc(NCC4CCCO4)n3)cc2)CC1 |
| InChI | InChI=1S/C19H27N7O/c1-25-8-10-26(11-9-25)16-6-4-15(5-7-16)22-18-14-21-24-19(23-18)20-13-17-3-2-12-27-17/h4-7,14,17H,2-3,8-13H2,1H3,(H2,20,22,23,24) |
| InChIKey | GYFPWJHMOVPIKF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|