C20H30N8O — CID 112945380
5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N-(2-morpholin-4-ylethyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112945380) has the molecular formula C20H30N8O and a molecular weight of 398.52 g/mol. Its IUPAC name is 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N-(2-morpholin-4-ylethyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N-(2-morpholin-4-ylethyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112945380 |
| Molecular Formula | C20H30N8O |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 5-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-N-(2-morpholin-4-ylethyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CN1CCN(c2ccc(Nc3cnnc(NCCN4CCOCC4)n3)cc2)CC1 |
| InChI | InChI=1S/C20H30N8O/c1-26-8-10-28(11-9-26)18-4-2-17(3-5-18)23-19-16-22-25-20(24-19)21-6-7-27-12-14-29-15-13-27/h2-5,16H,6-15H2,1H3,(H2,21,23,24,25) |
| InChIKey | VEMHKJSMFHEGKP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|