C21H25N7 — CID 112968809
5-N-[4-(dimethylamino)phenyl]-3-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112968809) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is 5-N-[4-(dimethylamino)phenyl]-3-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[4-(dimethylamino)phenyl]-3-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112968809 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 5-N-[4-(dimethylamino)phenyl]-3-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CN(C)c1ccc(Nc2cnnc(Nc3ccc(N4CCCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C21H25N7/c1-27(2)18-9-5-16(6-10-18)23-20-15-22-26-21(25-20)24-17-7-11-19(12-8-17)28-13-3-4-14-28/h5-12,15H,3-4,13-14H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | RGMNXYTUTWYBLS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|