C14H15ClN6O — CID 112946753
4-[5-(4-chloroanilino)-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde (PubChem CID 112946753) has the molecular formula C14H15ClN6O and a molecular weight of 318.77 g/mol. Its IUPAC name is 4-[5-(4-chloroanilino)-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[5-(4-chloroanilino)-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112946753 |
| Molecular Formula | C14H15ClN6O |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-[5-(4-chloroanilino)-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2nncc(Nc3ccc(Cl)cc3)n2)CC1 |
| InChI | InChI=1S/C14H15ClN6O/c15-11-1-3-12(4-2-11)17-13-9-16-19-14(18-13)21-7-5-20(10-22)6-8-21/h1-4,9-10H,5-8H2,(H,17,18,19) |
| InChIKey | JDRVIPGKKRZEBN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|