C12H20N6O — CID 112946711
4-[5-(tert-butylamino)-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde (PubChem CID 112946711) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[5-(tert-butylamino)-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[5-(tert-butylamino)-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112946711 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 4-[5-(tert-butylamino)-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
| SMILES | CC(C)(C)Nc1cnnc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C12H20N6O/c1-12(2,3)15-10-8-13-16-11(14-10)18-6-4-17(9-19)5-7-18/h8-9H,4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | DMMARIWSSTUNDT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|