C12H21N7O — CID 112944713
4-[5-[2-(dimethylamino)ethylamino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde (PubChem CID 112944713) has the molecular formula C12H21N7O and a molecular weight of 279.35 g/mol. Its IUPAC name is 4-[5-[2-(dimethylamino)ethylamino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[5-[2-(dimethylamino)ethylamino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112944713 |
| Molecular Formula | C12H21N7O |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 4-[5-[2-(dimethylamino)ethylamino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
| SMILES | CN(C)CCNc1cnnc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C12H21N7O/c1-17(2)4-3-13-11-9-14-16-12(15-11)19-7-5-18(10-20)6-8-19/h9-10H,3-8H2,1-2H3,(H,13,15,16) |
| InChIKey | YBFCQGLODHMHHK-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|