C19H29N7 — CID 112945449
N-[3-(4-benzylpiperazin-1-yl)-1,2,4-triazin-5-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 112945449) has the molecular formula C19H29N7 and a molecular weight of 355.49 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)-1,2,4-triazin-5-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)-1,2,4-triazin-5-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 112945449 |
| Molecular Formula | C19H29N7 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)-1,2,4-triazin-5-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1cnnc(N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H29N7/c1-24(2)10-6-9-20-18-15-21-23-19(22-18)26-13-11-25(12-14-26)16-17-7-4-3-5-8-17/h3-5,7-8,15H,6,9-14,16H2,1-2H3,(H,20,22,23) |
| InChIKey | VOKVVQNCPFGVRH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|