C17H26N6 — CID 112945648
3-N-[3-(dimethylamino)propyl]-5-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112945648) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 3-N-[3-(dimethylamino)propyl]-5-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[3-(dimethylamino)propyl]-5-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112945648 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 3-N-[3-(dimethylamino)propyl]-5-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CN(C)CCCNc1nncc(NCCCc2ccccc2)n1 |
| InChI | InChI=1S/C17H26N6/c1-23(2)13-7-12-19-17-21-16(14-20-22-17)18-11-6-10-15-8-4-3-5-9-15/h3-5,8-9,14H,6-7,10-13H2,1-2H3,(H2,18,19,21,22) |
| InChIKey | PMWCSDQKSOSHQL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|