C20H23N5 — CID 112958457
3-N-(3,5-dimethylphenyl)-5-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112958457) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-N-(3,5-dimethylphenyl)-5-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(3,5-dimethylphenyl)-5-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112958457 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 3-N-(3,5-dimethylphenyl)-5-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1cc(C)cc(Nc2nncc(NCCCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H23N5/c1-15-11-16(2)13-18(12-15)23-20-24-19(14-22-25-20)21-10-6-9-17-7-4-3-5-8-17/h3-5,7-8,11-14H,6,9-10H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | LRXWERWBZXNJMM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|