C17H25N5 — CID 112958548
5-N-(3-methylbutyl)-3-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112958548) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 5-N-(3-methylbutyl)-3-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(3-methylbutyl)-3-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112958548 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 5-N-(3-methylbutyl)-3-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CC(C)CCNc1cnnc(NCCCc2ccccc2)n1 |
| InChI | InChI=1S/C17H25N5/c1-14(2)10-12-18-16-13-20-22-17(21-16)19-11-6-9-15-7-4-3-5-8-15/h3-5,7-8,13-14H,6,9-12H2,1-2H3,(H2,18,19,21,22) |
| InChIKey | UNSGOEPKTYUPAC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|