C19H21N5 — CID 112952784
3-N,5-N-bis(2-phenylethyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112952784) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-N,5-N-bis(2-phenylethyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N,5-N-bis(2-phenylethyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112952784 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-N,5-N-bis(2-phenylethyl)-1,2,4-triazine-3,5-diamine |
| SMILES | c1ccc(CCNc2cnnc(NCCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H21N5/c1-3-7-16(8-4-1)11-13-20-18-15-22-24-19(23-18)21-14-12-17-9-5-2-6-10-17/h1-10,15H,11-14H2,(H2,20,21,23,24) |
| InChIKey | WUHQUGQVJJCEGL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |