C18H20N6 — CID 112952032
5-N-(3-phenylpropyl)-3-N-(pyridin-2-ylmethyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112952032) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-N-(3-phenylpropyl)-3-N-(pyridin-2-ylmethyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(3-phenylpropyl)-3-N-(pyridin-2-ylmethyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112952032 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 5-N-(3-phenylpropyl)-3-N-(pyridin-2-ylmethyl)-1,2,4-triazine-3,5-diamine |
| SMILES | c1ccc(CCCNc2cnnc(NCc3ccccn3)n2)cc1 |
| InChI | InChI=1S/C18H20N6/c1-2-7-15(8-3-1)9-6-12-20-17-14-22-24-18(23-17)21-13-16-10-4-5-11-19-16/h1-5,7-8,10-11,14H,6,9,12-13H2,(H2,20,21,23,24) |
| InChIKey | YHPMAGPGESTZHZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|