C18H28N6 — CID 112945509
3-N-(2-tert-butylphenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112945509) has the molecular formula C18H28N6 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-N-(2-tert-butylphenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2-tert-butylphenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112945509 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 3-N-(2-tert-butylphenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CN(C)CCCNc1cnnc(Nc2ccccc2C(C)(C)C)n1 |
| InChI | InChI=1S/C18H28N6/c1-18(2,3)14-9-6-7-10-15(14)21-17-22-16(13-20-23-17)19-11-8-12-24(4)5/h6-7,9-10,13H,8,11-12H2,1-5H3,(H2,19,21,22,23) |
| InChIKey | IFNKDULLWNNRBT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|