C15H27N7O2 — CID 112945459
ethyl 4-[5-[3-(dimethylamino)propylamino]-1,2,4-triazin-3-yl]piperazine-1-carboxylate (PubChem CID 112945459) has the molecular formula C15H27N7O2 and a molecular weight of 337.43 g/mol. Its IUPAC name is ethyl 4-[5-[3-(dimethylamino)propylamino]-1,2,4-triazin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-[3-(dimethylamino)propylamino]-1,2,4-triazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112945459 |
| Molecular Formula | C15H27N7O2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | ethyl 4-[5-[3-(dimethylamino)propylamino]-1,2,4-triazin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nncc(NCCCN(C)C)n2)CC1 |
| InChI | InChI=1S/C15H27N7O2/c1-4-24-15(23)22-10-8-21(9-11-22)14-18-13(12-17-19-14)16-6-5-7-20(2)3/h12H,4-11H2,1-3H3,(H,16,18,19) |
| InChIKey | BOIRBPRFZOJYLO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|