C15H26N6O2 — CID 112887005
ethyl 4-[4-[2-(dimethylamino)ethylamino]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 112887005) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is ethyl 4-[4-[2-(dimethylamino)ethylamino]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[2-(dimethylamino)ethylamino]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112887005 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | ethyl 4-[4-[2-(dimethylamino)ethylamino]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nccc(NCCN(C)C)n2)CC1 |
| InChI | InChI=1S/C15H26N6O2/c1-4-23-15(22)21-11-9-20(10-12-21)14-17-6-5-13(18-14)16-7-8-19(2)3/h5-6H,4,7-12H2,1-3H3,(H,16,17,18) |
| InChIKey | BPPNVZYWTIUDHA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |