C16H28N6O2 — CID 112870224
ethyl 4-[6-[2-(dimethylamino)ethylamino]-2-methylpyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 112870224) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is ethyl 4-[6-[2-(dimethylamino)ethylamino]-2-methylpyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[2-(dimethylamino)ethylamino]-2-methylpyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112870224 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | ethyl 4-[6-[2-(dimethylamino)ethylamino]-2-methylpyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(NCCN(C)C)nc(C)n2)CC1 |
| InChI | InChI=1S/C16H28N6O2/c1-5-24-16(23)22-10-8-21(9-11-22)15-12-14(18-13(2)19-15)17-6-7-20(3)4/h12H,5-11H2,1-4H3,(H,17,18,19) |
| InChIKey | XLZCOMYGKZARGH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |