C16H26N6O3 — CID 109115372
ethyl 4-[6-[2-(dimethylamino)ethylcarbamoyl]pyridazin-3-yl]piperazine-1-carboxylate (PubChem CID 109115372) has the molecular formula C16H26N6O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 4-[6-[2-(dimethylamino)ethylcarbamoyl]pyridazin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[2-(dimethylamino)ethylcarbamoyl]pyridazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109115372 |
| Molecular Formula | C16H26N6O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethyl 4-[6-[2-(dimethylamino)ethylcarbamoyl]pyridazin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc(C(=O)NCCN(C)C)nn2)CC1 |
| InChI | InChI=1S/C16H26N6O3/c1-4-25-16(24)22-11-9-21(10-12-22)14-6-5-13(18-19-14)15(23)17-7-8-20(2)3/h5-6H,4,7-12H2,1-3H3,(H,17,23) |
| InChIKey | JYVRVJHJKNHJOH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |