C18H30N6O3 — CID 109115992
ethyl 4-[[6-[3-(dimethylamino)propylcarbamoyl]pyridazin-3-yl]amino]piperidine-1-carboxylate (PubChem CID 109115992) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is ethyl 4-[[6-[3-(dimethylamino)propylcarbamoyl]pyridazin-3-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-[3-(dimethylamino)propylcarbamoyl]pyridazin-3-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109115992 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | ethyl 4-[[6-[3-(dimethylamino)propylcarbamoyl]pyridazin-3-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(C(=O)NCCCN(C)C)nn2)CC1 |
| InChI | InChI=1S/C18H30N6O3/c1-4-27-18(26)24-12-8-14(9-13-24)20-16-7-6-15(21-22-16)17(25)19-10-5-11-23(2)3/h6-7,14H,4-5,8-13H2,1-3H3,(H,19,25)(H,20,22) |
| InChIKey | NXLQAIAHFNRFCO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|