C16H24N6O3 — CID 113043558
ethyl 4-[[6-(cyclopropylcarbamoylamino)pyridazin-3-yl]amino]piperidine-1-carboxylate (PubChem CID 113043558) has the molecular formula C16H24N6O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is ethyl 4-[[6-(cyclopropylcarbamoylamino)pyridazin-3-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(cyclopropylcarbamoylamino)pyridazin-3-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113043558 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | ethyl 4-[[6-(cyclopropylcarbamoylamino)pyridazin-3-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(NC(=O)NC3CC3)nn2)CC1 |
| InChI | InChI=1S/C16H24N6O3/c1-2-25-16(24)22-9-7-12(8-10-22)17-13-5-6-14(21-20-13)19-15(23)18-11-3-4-11/h5-6,11-12H,2-4,7-10H2,1H3,(H,17,20)(H2,18,19,21,23) |
| InChIKey | QGDJNBMASBYZHP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |