C14H18Cl2N4O3 — CID 23876750
ethyl 4-[(2,6-dichloro-4-pyridinyl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 23876750) has the molecular formula C14H18Cl2N4O3 and a molecular weight of 361.23 g/mol. Its IUPAC name is ethyl 4-[(2,6-dichloro-4-pyridinyl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2,6-dichloro-4-pyridinyl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23876750 |
| Molecular Formula | C14H18Cl2N4O3 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | ethyl 4-[(2,6-dichloro-4-pyridinyl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Nc2cc(Cl)nc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H18Cl2N4O3/c1-2-23-14(22)20-5-3-9(4-6-20)17-13(21)18-10-7-11(15)19-12(16)8-10/h7-9H,2-6H2,1H3,(H2,17,18,19,21) |
| InChIKey | PYFHXPFAAHYDTQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|