C17H22ClN3O5 — CID 47040600
ethyl 4-[(4-chloro-3-methoxycarbonylphenyl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 47040600) has the molecular formula C17H22ClN3O5 and a molecular weight of 383.83 g/mol. Its IUPAC name is ethyl 4-[(4-chloro-3-methoxycarbonylphenyl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-chloro-3-methoxycarbonylphenyl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 47040600 |
| Molecular Formula | C17H22ClN3O5 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | ethyl 4-[(4-chloro-3-methoxycarbonylphenyl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Nc2ccc(Cl)c(C(=O)OC)c2)CC1 |
| InChI | InChI=1S/C17H22ClN3O5/c1-3-26-17(24)21-8-6-11(7-9-21)19-16(23)20-12-4-5-14(18)13(10-12)15(22)25-2/h4-5,10-11H,3,6-9H2,1-2H3,(H2,19,20,23) |
| InChIKey | QETROOAPSIADOJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |