C17H21ClFN3O4 — CID 108950255
ethyl 4-[[3-(3-chloro-4-fluoroanilino)-3-oxopropanoyl]amino]piperidine-1-carboxylate (PubChem CID 108950255) has the molecular formula C17H21ClFN3O4 and a molecular weight of 385.82 g/mol. Its IUPAC name is ethyl 4-[[3-(3-chloro-4-fluoroanilino)-3-oxopropanoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-(3-chloro-4-fluoroanilino)-3-oxopropanoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108950255 |
| Molecular Formula | C17H21ClFN3O4 |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | ethyl 4-[[3-(3-chloro-4-fluoroanilino)-3-oxopropanoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CC(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H21ClFN3O4/c1-2-26-17(25)22-7-5-11(6-8-22)20-15(23)10-16(24)21-12-3-4-14(19)13(18)9-12/h3-4,9,11H,2,5-8,10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | GCYXWJKZQIOCDL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|