C15H20ClN3O3 — CID 17423931
ethyl 4-[(3-chlorophenyl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 17423931) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is ethyl 4-[(3-chlorophenyl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3-chlorophenyl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 17423931 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | ethyl 4-[(3-chlorophenyl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-2-22-15(21)19-8-6-12(7-9-19)17-14(20)18-13-5-3-4-11(16)10-13/h3-5,10,12H,2,6-9H2,1H3,(H2,17,18,20) |
| InChIKey | PVEADLMCJRJUEP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |