C18H21N3O5 — CID 72861714
ethyl 4-[(4-oxochromen-6-yl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 72861714) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is ethyl 4-[(4-oxochromen-6-yl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-oxochromen-6-yl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 72861714 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | ethyl 4-[(4-oxochromen-6-yl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Nc2ccc3occc(=O)c3c2)CC1 |
| InChI | InChI=1S/C18H21N3O5/c1-2-25-18(24)21-8-5-12(6-9-21)19-17(23)20-13-3-4-16-14(11-13)15(22)7-10-26-16/h3-4,7,10-12H,2,5-6,8-9H2,1H3,(H2,19,20,23) |
| InChIKey | PEEOJMHRHMSZAT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |