C21H34N4O3 — CID 119049002
ethyl 4-[[4-[2-(diethylamino)ethyl]phenyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 119049002) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is ethyl 4-[[4-[2-(diethylamino)ethyl]phenyl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[2-(diethylamino)ethyl]phenyl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 119049002 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | ethyl 4-[[4-[2-(diethylamino)ethyl]phenyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Nc2ccc(CCN(CC)CC)cc2)CC1 |
| InChI | InChI=1S/C21H34N4O3/c1-4-24(5-2)14-11-17-7-9-18(10-8-17)22-20(26)23-19-12-15-25(16-13-19)21(27)28-6-3/h7-10,19H,4-6,11-16H2,1-3H3,(H2,22,23,26) |
| InChIKey | VXPXURWGVKWBEZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |