C17H23N7O3 — CID 72927518
ethyl 4-[[4-(2-methyltetrazol-5-yl)phenyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 72927518) has the molecular formula C17H23N7O3 and a molecular weight of 373.42 g/mol. Its IUPAC name is ethyl 4-[[4-(2-methyltetrazol-5-yl)phenyl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-(2-methyltetrazol-5-yl)phenyl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 72927518 |
| Molecular Formula | C17H23N7O3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | ethyl 4-[[4-(2-methyltetrazol-5-yl)phenyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Nc2ccc(-c3nnn(C)n3)cc2)CC1 |
| InChI | InChI=1S/C17H23N7O3/c1-3-27-17(26)24-10-8-14(9-11-24)19-16(25)18-13-6-4-12(5-7-13)15-20-22-23(2)21-15/h4-7,14H,3,8-11H2,1-2H3,(H2,18,19,25) |
| InChIKey | NTACDXPUGFDONC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |