C22H25N7O2 — CID 51052796
N-(1-benzylpiperidin-4-yl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide (PubChem CID 51052796) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51052796 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
| SMILES | Cn1nnc(-c2ccc(NC(=O)C(=O)NC3CCN(Cc4ccccc4)CC3)cc2)n1 |
| InChI | InChI=1S/C22H25N7O2/c1-28-26-20(25-27-28)17-7-9-18(10-8-17)23-21(30)22(31)24-19-11-13-29(14-12-19)15-16-5-3-2-4-6-16/h2-10,19H,11-15H2,1H3,(H,23,30)(H,24,31) |
| InChIKey | ZRKGHNYMMKGHPS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|