C17H15FN6O2 — CID 51049331
N-[(3-fluorophenyl)methyl]-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide (PubChem CID 51049331) has the molecular formula C17H15FN6O2 and a molecular weight of 354.35 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51049331 |
| Molecular Formula | C17H15FN6O2 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
| SMILES | Cn1nnc(-c2ccc(NC(=O)C(=O)NCc3cccc(F)c3)cc2)n1 |
| InChI | InChI=1S/C17H15FN6O2/c1-24-22-15(21-23-24)12-5-7-14(8-6-12)20-17(26)16(25)19-10-11-3-2-4-13(18)9-11/h2-9H,10H2,1H3,(H,19,25)(H,20,26) |
| InChIKey | BNRVFFNDLONTDN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|