C14H16N6O2 — CID 51053226
N-(cyclopropylmethyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide (PubChem CID 51053226) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide.
| Compound Name | N-(cyclopropylmethyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51053226 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
| SMILES | Cn1nnc(-c2ccc(NC(=O)C(=O)NCC3CC3)cc2)n1 |
| InChI | InChI=1S/C14H16N6O2/c1-20-18-12(17-19-20)10-4-6-11(7-5-10)16-14(22)13(21)15-8-9-2-3-9/h4-7,9H,2-3,8H2,1H3,(H,15,21)(H,16,22) |
| InChIKey | WUDUDEAWDGUENB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|