C14H18N6O3 — CID 51053045
N'-(1-hydroxy-2-methylpropan-2-yl)-N-[4-(2-methyltetrazol-5-yl)phenyl]oxamide (PubChem CID 51053045) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is N'-(1-hydroxy-2-methylpropan-2-yl)-N-[4-(2-methyltetrazol-5-yl)phenyl]oxamide.
| Compound Name | N'-(1-hydroxy-2-methylpropan-2-yl)-N-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51053045 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N'-(1-hydroxy-2-methylpropan-2-yl)-N-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
| SMILES | Cn1nnc(-c2ccc(NC(=O)C(=O)NC(C)(C)CO)cc2)n1 |
| InChI | InChI=1S/C14H18N6O3/c1-14(2,8-21)16-13(23)12(22)15-10-6-4-9(5-7-10)11-17-19-20(3)18-11/h4-7,21H,8H2,1-3H3,(H,15,22)(H,16,23) |
| InChIKey | ZLWNKNJFPRSBLX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|