C13H16N6O3 — CID 75605546
N-(2-hydroxypropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide (PubChem CID 75605546) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide.
| Compound Name | N-(2-hydroxypropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 75605546 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-(2-hydroxypropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
| SMILES | CC(O)CNC(=O)C(=O)Nc1ccc(-c2nnn(C)n2)cc1 |
| InChI | InChI=1S/C13H16N6O3/c1-8(20)7-14-12(21)13(22)15-10-5-3-9(4-6-10)11-16-18-19(2)17-11/h3-6,8,20H,7H2,1-2H3,(H,14,21)(H,15,22) |
| InChIKey | PVWCWHYGQMUKJQ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|