C16H20N6O2 — CID 108519242
N-(1-benzylpiperidin-4-yl)-N'-(1,2,4-triazol-4-yl)oxamide (PubChem CID 108519242) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N'-(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N'-(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 108519242 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N'-(1,2,4-triazol-4-yl)oxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)C(=O)Nn1cnnc1 |
| InChI | InChI=1S/C16H20N6O2/c23-15(16(24)20-22-11-17-18-12-22)19-14-6-8-21(9-7-14)10-13-4-2-1-3-5-13/h1-5,11-12,14H,6-10H2,(H,19,23)(H,20,24) |
| InChIKey | CRMUSEQJUIUTNW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|