C26H37N3O2 — CID 108509213
N'-[1-(1-adamantyl)ethyl]-N-(1-benzylpiperidin-4-yl)oxamide (PubChem CID 108509213) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is N'-[1-(1-adamantyl)ethyl]-N-(1-benzylpiperidin-4-yl)oxamide.
| Compound Name | N'-[1-(1-adamantyl)ethyl]-N-(1-benzylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108509213 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N'-[1-(1-adamantyl)ethyl]-N-(1-benzylpiperidin-4-yl)oxamide |
| SMILES | CC(NC(=O)C(=O)NC1CCN(Cc2ccccc2)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H37N3O2/c1-18(26-14-20-11-21(15-26)13-22(12-20)16-26)27-24(30)25(31)28-23-7-9-29(10-8-23)17-19-5-3-2-4-6-19/h2-6,18,20-23H,7-17H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | DXACNZBNELPEQF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|