C23H32N2O2 — CID 108509082
N-[1-(1-adamantyl)ethyl]-N'-benzyl-N'-ethyloxamide (PubChem CID 108509082) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-N'-benzyl-N'-ethyloxamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-N'-benzyl-N'-ethyloxamide |
|---|---|
| PubChem CID | 108509082 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-N'-benzyl-N'-ethyloxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(=O)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H32N2O2/c1-3-25(15-17-7-5-4-6-8-17)22(27)21(26)24-16(2)23-12-18-9-19(13-23)11-20(10-18)14-23/h4-8,16,18-20H,3,9-15H2,1-2H3,(H,24,26) |
| InChIKey | GLAJEHQSOVTLKE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|